C26H27F2NO5 — CID 22923928
3-O-(2-phenoxyethyl) 5-O-propan-2-yl 4-(2,5-difluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 22923928) has the molecular formula C26H27F2NO5 and a molecular weight of 471.50 g/mol. Its IUPAC name is 3-O-(2-phenoxyethyl) 5-O-propan-2-yl 4-(2,5-difluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-(2-phenoxyethyl) 5-O-propan-2-yl 4-(2,5-difluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 22923928 |
| Molecular Formula | C26H27F2NO5 |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 3-O-(2-phenoxyethyl) 5-O-propan-2-yl 4-(2,5-difluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCOc2ccccc2)C(c2cc(F)ccc2F)C(C(=O)OC(C)C)=C(C)N1 |
| InChI | InChI=1S/C26H27F2NO5/c1-15(2)34-26(31)23-17(4)29-16(3)22(24(23)20-14-18(27)10-11-21(20)28)25(30)33-13-12-32-19-8-6-5-7-9-19/h5-11,14-15,24,29H,12-13H2,1-4H3 |
| InChIKey | SZSMMVWIISBTCC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|