C28H29F2NO5 — CID 22923922
5-O-cyclopentyl 3-O-(2-phenoxyethyl) 4-(2,5-difluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 22923922) has the molecular formula C28H29F2NO5 and a molecular weight of 497.54 g/mol. Its IUPAC name is 5-O-cyclopentyl 3-O-(2-phenoxyethyl) 4-(2,5-difluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-cyclopentyl 3-O-(2-phenoxyethyl) 4-(2,5-difluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 22923922 |
| Molecular Formula | C28H29F2NO5 |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 5-O-cyclopentyl 3-O-(2-phenoxyethyl) 4-(2,5-difluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCOc2ccccc2)C(c2cc(F)ccc2F)C(C(=O)OC2CCCC2)=C(C)N1 |
| InChI | InChI=1S/C28H29F2NO5/c1-17-24(27(32)35-15-14-34-20-8-4-3-5-9-20)26(22-16-19(29)12-13-23(22)30)25(18(2)31-17)28(33)36-21-10-6-7-11-21/h3-5,8-9,12-13,16,21,26,31H,6-7,10-11,14-15H2,1-2H3 |
| InChIKey | ATBQPCUKIXDAKX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|