About 1-chloro-4-ethylbenzene;1-(4-chlorophenyl)ethanol
1-chloro-4-ethylbenzene;1-(4-chlorophenyl)ethanol (PubChem CID 22925659) has the molecular formula C16H18Cl2O
and a molecular weight of 297.23 g/mol. Its IUPAC name is 1-chloro-4-ethylbenzene;1-(4-chlorophenyl)ethanol.
Molecular Properties
| Compound Name | 1-chloro-4-ethylbenzene;1-(4-chlorophenyl)ethanol |
| PubChem CID | 22925659 |
| Molecular Formula | C16H18Cl2O |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 1-chloro-4-ethylbenzene;1-(4-chlorophenyl)ethanol |
| SMILES | CC(O)c1ccc(Cl)cc1.CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H9ClO.C8H9Cl/c1-6(10)7-2-4-8(9)5-3-7;1-2-7-3-5-8(9)6-4-7/h2-6,10H,1H3;3-6H,2H2,1H3 |
| InChIKey | DEAYUUINLXCRHX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-chloro-4-ethylbenzene;1-(4-chlorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-ethylbenzene;1-(4-chlorophenyl)ethanol?
The IUPAC name of 1-chloro-4-ethylbenzene;1-(4-chlorophenyl)ethanol (CID 22925659) is 1-chloro-4-ethylbenzene;1-(4-chlorophenyl)ethanol.
What is the SMILES notation for 1-chloro-4-ethylbenzene;1-(4-chlorophenyl)ethanol?
The canonical SMILES for 1-chloro-4-ethylbenzene;1-(4-chlorophenyl)ethanol is CC(O)c1ccc(Cl)cc1.CCc1ccc(Cl)cc1.
What is the InChIKey of 1-chloro-4-ethylbenzene;1-(4-chlorophenyl)ethanol?
The InChIKey is DEAYUUINLXCRHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO.C8H9Cl/c1-6(10)7-2-4-8(9)5-3-7;1-2-7-3-5-8(9)6-4-7/h2-6,10H,1H3;3-6H,2H2,1H3.
What are the key properties of 1-chloro-4-ethylbenzene;1-(4-chlorophenyl)ethanol?
1-chloro-4-ethylbenzene;1-(4-chlorophenyl)ethanol has a molecular weight of 297.23 g/mol, XLogP of 5.30, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-ethylbenzene;1-(4-chlorophenyl)ethanol is sourced from PubChem (CID 22925659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).