C33H34Cl2O6 — CID 66728211
1,3-bis(4-chlorophenyl)propane-1,3-diol;bis(4-ethylbenzoic acid) (PubChem CID 66728211) has the molecular formula C33H34Cl2O6 and a molecular weight of 597.54 g/mol. Its IUPAC name is 1,3-bis(4-chlorophenyl)propane-1,3-diol;bis(4-ethylbenzoic acid).
| Compound Name | 1,3-bis(4-chlorophenyl)propane-1,3-diol;bis(4-ethylbenzoic acid) |
|---|---|
| PubChem CID | 66728211 |
| Molecular Formula | C33H34Cl2O6 |
| Molecular Weight | 597.54 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | 1,3-bis(4-chlorophenyl)propane-1,3-diol;bis(4-ethylbenzoic acid) |
| SMILES | CCc1ccc(C(=O)O)cc1.CCc1ccc(C(=O)O)cc1.OC(CC(O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H14Cl2O2.2C9H10O2/c16-12-5-1-10(2-6-12)14(18)9-15(19)11-3-7-13(17)8-4-11;2*1-2-7-3-5-8(6-4-7)9(10)11/h1-8,14-15,18-19H,9H2;2*3-6H,2H2,1H3,(H,10,11) |
| InChIKey | TWAXWLIRPRFCSM-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.54 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |