C22H20ClNO4 — CID 141204468
4-[[1-(4-chlorophenyl)-3-hydroxy-3-(4-hydroxyphenyl)propyl]amino]benzoic acid (PubChem CID 141204468) has the molecular formula C22H20ClNO4 and a molecular weight of 397.86 g/mol. Its IUPAC name is 4-[[1-(4-chlorophenyl)-3-hydroxy-3-(4-hydroxyphenyl)propyl]amino]benzoic acid.
| Compound Name | 4-[[1-(4-chlorophenyl)-3-hydroxy-3-(4-hydroxyphenyl)propyl]amino]benzoic acid |
|---|---|
| PubChem CID | 141204468 |
| Molecular Formula | C22H20ClNO4 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 4-[[1-(4-chlorophenyl)-3-hydroxy-3-(4-hydroxyphenyl)propyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(CC(O)c2ccc(O)cc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H20ClNO4/c23-17-7-1-14(2-8-17)20(13-21(26)15-5-11-19(25)12-6-15)24-18-9-3-16(4-10-18)22(27)28/h1-12,20-21,24-26H,13H2,(H,27,28) |
| InChIKey | IKBWVYVHOHTHLW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |