C21H18Cl3NO — CID 132590818
3-(3-chloroanilino)-1,3-bis(4-chlorophenyl)propan-1-ol (PubChem CID 132590818) has the molecular formula C21H18Cl3NO and a molecular weight of 406.74 g/mol. Its IUPAC name is 3-(3-chloroanilino)-1,3-bis(4-chlorophenyl)propan-1-ol.
| Compound Name | 3-(3-chloroanilino)-1,3-bis(4-chlorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 132590818 |
| Molecular Formula | C21H18Cl3NO |
| Molecular Weight | 406.74 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 3-(3-chloroanilino)-1,3-bis(4-chlorophenyl)propan-1-ol |
| SMILES | OC(CC(Nc1cccc(Cl)c1)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18Cl3NO/c22-16-8-4-14(5-9-16)20(25-19-3-1-2-18(24)12-19)13-21(26)15-6-10-17(23)11-7-15/h1-12,20-21,25-26H,13H2 |
| InChIKey | GJJUSBBLPODDNT-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.74 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |