C23H24ClNO — CID 132590791
1-(4-chlorophenyl)-3-(4-ethylanilino)-3-phenylpropan-1-ol (PubChem CID 132590791) has the molecular formula C23H24ClNO and a molecular weight of 365.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(4-ethylanilino)-3-phenylpropan-1-ol.
| Compound Name | 1-(4-chlorophenyl)-3-(4-ethylanilino)-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 132590791 |
| Molecular Formula | C23H24ClNO |
| Molecular Weight | 365.90 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(4-ethylanilino)-3-phenylpropan-1-ol |
| SMILES | CCc1ccc(NC(CC(O)c2ccc(Cl)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H24ClNO/c1-2-17-8-14-21(15-9-17)25-22(18-6-4-3-5-7-18)16-23(26)19-10-12-20(24)13-11-19/h3-15,22-23,25-26H,2,16H2,1H3 |
| InChIKey | BBNFILHQEFMFBD-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.90 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |