C8H12N2OS — CID 22938641
3-(cyclopropylmethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione (PubChem CID 22938641) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is 3-(cyclopropylmethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione.
| Compound Name | 3-(cyclopropylmethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 22938641 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 3-(cyclopropylmethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione |
| SMILES | OCc1c[nH]c(=S)n1CC1CC1 |
| InChI | InChI=1S/C8H12N2OS/c11-5-7-3-9-8(12)10(7)4-6-1-2-6/h3,6,11H,1-2,4-5H2,(H,9,12) |
| InChIKey | JHZLADQXOVNTIE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 40.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|