C6H9N3O — CID 22938686
4-propyl-1,2,4-triazole-3-carbaldehyde (PubChem CID 22938686) has the molecular formula C6H9N3O and a molecular weight of 139.16 g/mol. Its IUPAC name is 4-propyl-1,2,4-triazole-3-carbaldehyde.
| Compound Name | 4-propyl-1,2,4-triazole-3-carbaldehyde |
|---|---|
| PubChem CID | 22938686 |
| Molecular Formula | C6H9N3O |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.07 |
| IUPAC Name | 4-propyl-1,2,4-triazole-3-carbaldehyde |
| SMILES | CCCn1cnnc1C=O |
| InChI | InChI=1S/C6H9N3O/c1-2-3-9-5-7-8-6(9)4-10/h4-5H,2-3H2,1H3 |
| InChIKey | SIWDLHCZHLPJAX-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|