C14H8N2O3S — CID 22939340
4-oxo-2-pyridin-2-yl-1,3-benzothiazine-7-carboxylic acid (PubChem CID 22939340) has the molecular formula C14H8N2O3S and a molecular weight of 284.30 g/mol. Its IUPAC name is 4-oxo-2-pyridin-2-yl-1,3-benzothiazine-7-carboxylic acid.
| Compound Name | 4-oxo-2-pyridin-2-yl-1,3-benzothiazine-7-carboxylic acid |
|---|---|
| PubChem CID | 22939340 |
| Molecular Formula | C14H8N2O3S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 4-oxo-2-pyridin-2-yl-1,3-benzothiazine-7-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(=O)nc(-c3ccccn3)sc2c1 |
| InChI | InChI=1S/C14H8N2O3S/c17-12-9-5-4-8(14(18)19)7-11(9)20-13(16-12)10-3-1-2-6-15-10/h1-7H,(H,18,19) |
| InChIKey | OGRLLZFUGYPDPO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |