C16H8O4S2 — CID 58150677
[1]benzothiolo[3,2-b][1]benzothiole-2,7-dicarboxylic acid (PubChem CID 58150677) has the molecular formula C16H8O4S2 and a molecular weight of 328.37 g/mol. Its IUPAC name is [1]benzothiolo[3,2-b][1]benzothiole-2,7-dicarboxylic acid.
| Compound Name | [1]benzothiolo[3,2-b][1]benzothiole-2,7-dicarboxylic acid |
|---|---|
| PubChem CID | 58150677 |
| Molecular Formula | C16H8O4S2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | [1]benzothiolo[3,2-b][1]benzothiole-2,7-dicarboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)sc1c3ccc(C(=O)O)cc3sc21 |
| InChI | InChI=1S/C16H8O4S2/c17-15(18)7-1-3-9-11(5-7)21-14-10-4-2-8(16(19)20)6-12(10)22-13(9)14/h1-6H,(H,17,18)(H,19,20) |
| InChIKey | PDVQQWQSJAFOIJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |