C18H17N3O3S — CID 22939388
tert-butyl N-[2-(4-oxo-1,3-benzothiazin-2-yl)-4-pyridinyl]carbamate (PubChem CID 22939388) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is tert-butyl N-[2-(4-oxo-1,3-benzothiazin-2-yl)-4-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-oxo-1,3-benzothiazin-2-yl)-4-pyridinyl]carbamate |
|---|---|
| PubChem CID | 22939388 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | tert-butyl N-[2-(4-oxo-1,3-benzothiazin-2-yl)-4-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccnc(-c2nc(=O)c3ccccc3s2)c1 |
| InChI | InChI=1S/C18H17N3O3S/c1-18(2,3)24-17(23)20-11-8-9-19-13(10-11)16-21-15(22)12-6-4-5-7-14(12)25-16/h4-10H,1-3H3,(H,19,20,23) |
| InChIKey | UTSCHKPAIWRPFG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |