About [6-chloro-3-(2-methylphenoxy)pyridazin-4-yl] 2,2,2-trichloroethyl carbonate
[6-chloro-3-(2-methylphenoxy)pyridazin-4-yl] 2,2,2-trichloroethyl carbonate (PubChem CID 22940045) has the molecular formula C14H10Cl4N2O4
and a molecular weight of 412.06 g/mol. Its IUPAC name is [6-chloro-3-(2-methylphenoxy)pyridazin-4-yl] 2,2,2-trichloroethyl carbonate.
Molecular Properties
| Compound Name | [6-chloro-3-(2-methylphenoxy)pyridazin-4-yl] 2,2,2-trichloroethyl carbonate |
| PubChem CID | 22940045 |
| Molecular Formula | C14H10Cl4N2O4 |
| Molecular Weight | 412.06 g/mol |
| Exact Mass | 409.94 |
| IUPAC Name | [6-chloro-3-(2-methylphenoxy)pyridazin-4-yl] 2,2,2-trichloroethyl carbonate |
| SMILES | Cc1ccccc1Oc1nnc(Cl)cc1OC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H10Cl4N2O4/c1-8-4-2-3-5-9(8)23-12-10(6-11(15)19-20-12)24-13(21)22-7-14(16,17)18/h2-6H,7H2,1H3 |
| InChIKey | WOISGNKNRPWWKI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.06 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [6-chloro-3-(2-methylphenoxy)pyridazin-4-yl] 2,2,2-trichloroethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-chloro-3-(2-methylphenoxy)pyridazin-4-yl] 2,2,2-trichloroethyl carbonate?
The IUPAC name of [6-chloro-3-(2-methylphenoxy)pyridazin-4-yl] 2,2,2-trichloroethyl carbonate (CID 22940045) is [6-chloro-3-(2-methylphenoxy)pyridazin-4-yl] 2,2,2-trichloroethyl carbonate.
What is the SMILES notation for [6-chloro-3-(2-methylphenoxy)pyridazin-4-yl] 2,2,2-trichloroethyl carbonate?
The canonical SMILES for [6-chloro-3-(2-methylphenoxy)pyridazin-4-yl] 2,2,2-trichloroethyl carbonate is Cc1ccccc1Oc1nnc(Cl)cc1OC(=O)OCC(Cl)(Cl)Cl.
What is the InChIKey of [6-chloro-3-(2-methylphenoxy)pyridazin-4-yl] 2,2,2-trichloroethyl carbonate?
The InChIKey is WOISGNKNRPWWKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl4N2O4/c1-8-4-2-3-5-9(8)23-12-10(6-11(15)19-20-12)24-13(21)22-7-14(16,17)18/h2-6H,7H2,1H3.
What are the key properties of [6-chloro-3-(2-methylphenoxy)pyridazin-4-yl] 2,2,2-trichloroethyl carbonate?
[6-chloro-3-(2-methylphenoxy)pyridazin-4-yl] 2,2,2-trichloroethyl carbonate has a molecular weight of 412.06 g/mol, XLogP of 5.12, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-chloro-3-(2-methylphenoxy)pyridazin-4-yl] 2,2,2-trichloroethyl carbonate is sourced from PubChem (CID 22940045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).