C14H10Cl4N2O4 — CID 22940045
[6-chloro-3-(2-methylphenoxy)pyridazin-4-yl] 2,2,2-trichloroethyl carbonate (PubChem CID 22940045) has the molecular formula C14H10Cl4N2O4 and a molecular weight of 412.06 g/mol. Its IUPAC name is [6-chloro-3-(2-methylphenoxy)pyridazin-4-yl] 2,2,2-trichloroethyl carbonate.
| Compound Name | [6-chloro-3-(2-methylphenoxy)pyridazin-4-yl] 2,2,2-trichloroethyl carbonate |
|---|---|
| PubChem CID | 22940045 |
| Molecular Formula | C14H10Cl4N2O4 |
| Molecular Weight | 412.06 g/mol |
| Exact Mass | 409.94 |
| IUPAC Name | [6-chloro-3-(2-methylphenoxy)pyridazin-4-yl] 2,2,2-trichloroethyl carbonate |
| SMILES | Cc1ccccc1Oc1nnc(Cl)cc1OC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H10Cl4N2O4/c1-8-4-2-3-5-9(8)23-12-10(6-11(15)19-20-12)24-13(21)22-7-14(16,17)18/h2-6H,7H2,1H3 |
| InChIKey | WOISGNKNRPWWKI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.06 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|