C21H19ClN2O3 — CID 57464536
[6-chloro-3-(2-propan-2-ylphenoxy)pyridazin-4-yl] 4-methylbenzoate (PubChem CID 57464536) has the molecular formula C21H19ClN2O3 and a molecular weight of 382.85 g/mol. Its IUPAC name is [6-chloro-3-(2-propan-2-ylphenoxy)pyridazin-4-yl] 4-methylbenzoate.
| Compound Name | [6-chloro-3-(2-propan-2-ylphenoxy)pyridazin-4-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 57464536 |
| Molecular Formula | C21H19ClN2O3 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | [6-chloro-3-(2-propan-2-ylphenoxy)pyridazin-4-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2cc(Cl)nnc2Oc2ccccc2C(C)C)cc1 |
| InChI | InChI=1S/C21H19ClN2O3/c1-13(2)16-6-4-5-7-17(16)26-20-18(12-19(22)23-24-20)27-21(25)15-10-8-14(3)9-11-15/h4-13H,1-3H3 |
| InChIKey | AIHAIMGZHFPYOP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |