C28H42N2OS — CID 22940559
2-nonyl-6-[4-[(2S)-octan-2-yl]oxyphenyl]imidazo[2,1-b][1,3]thiazole (PubChem CID 22940559) has the molecular formula C28H42N2OS and a molecular weight of 454.72 g/mol. Its IUPAC name is 2-nonyl-6-[4-[(2S)-octan-2-yl]oxyphenyl]imidazo[2,1-b][1,3]thiazole.
| Compound Name | 2-nonyl-6-[4-[(2S)-octan-2-yl]oxyphenyl]imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 22940559 |
| Molecular Formula | C28H42N2OS |
| Molecular Weight | 454.72 g/mol |
| Exact Mass | 454.30 |
| IUPAC Name | 2-nonyl-6-[4-[(2S)-octan-2-yl]oxyphenyl]imidazo[2,1-b][1,3]thiazole |
| SMILES | CCCCCCCCCc1cn2cc(-c3ccc(O[C@@H](C)CCCCCC)cc3)nc2s1 |
| InChI | InChI=1S/C28H42N2OS/c1-4-6-8-10-11-12-14-16-26-21-30-22-27(29-28(30)32-26)24-17-19-25(20-18-24)31-23(3)15-13-9-7-5-2/h17-23H,4-16H2,1-3H3/t23-/m0/s1 |
| InChIKey | ROXDDHVDOPUYLX-QHCPKHFHSA-N |
| XLogP | 9.09 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.72 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|