C27H39FN2OS — CID 22940562
6-[2-fluoro-4-[(2S)-octan-2-yl]oxyphenyl]-2-octylimidazo[2,1-b][1,3]thiazole (PubChem CID 22940562) has the molecular formula C27H39FN2OS and a molecular weight of 458.69 g/mol. Its IUPAC name is 6-[2-fluoro-4-[(2S)-octan-2-yl]oxyphenyl]-2-octylimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-[2-fluoro-4-[(2S)-octan-2-yl]oxyphenyl]-2-octylimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 22940562 |
| Molecular Formula | C27H39FN2OS |
| Molecular Weight | 458.69 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | 6-[2-fluoro-4-[(2S)-octan-2-yl]oxyphenyl]-2-octylimidazo[2,1-b][1,3]thiazole |
| SMILES | CCCCCCCCc1cn2cc(-c3ccc(O[C@@H](C)CCCCCC)cc3F)nc2s1 |
| InChI | InChI=1S/C27H39FN2OS/c1-4-6-8-10-11-13-15-23-19-30-20-26(29-27(30)32-23)24-17-16-22(18-25(24)28)31-21(3)14-12-9-7-5-2/h16-21H,4-15H2,1-3H3/t21-/m0/s1 |
| InChIKey | FTPHANHITQTMQI-NRFANRHFSA-N |
| XLogP | 8.84 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.69 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|