C17H22N2S — CID 67743170
6-cyclohexa-1,3-dien-1-yl-2-hexylimidazo[2,1-b][1,3]thiazole (PubChem CID 67743170) has the molecular formula C17H22N2S and a molecular weight of 286.44 g/mol. Its IUPAC name is 6-cyclohexa-1,3-dien-1-yl-2-hexylimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-cyclohexa-1,3-dien-1-yl-2-hexylimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 67743170 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 6-cyclohexa-1,3-dien-1-yl-2-hexylimidazo[2,1-b][1,3]thiazole |
| SMILES | CCCCCCc1cn2cc(C3=CC=CCC3)nc2s1 |
| InChI | InChI=1S/C17H22N2S/c1-2-3-4-8-11-15-12-19-13-16(18-17(19)20-15)14-9-6-5-7-10-14/h5-6,9,12-13H,2-4,7-8,10-11H2,1H3 |
| InChIKey | GOZRVSWKDVZZNX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|