C8H13F — CID 22942559
2-fluoro-1,4-dimethylcyclohexene (PubChem CID 22942559) has the molecular formula C8H13F and a molecular weight of 128.19 g/mol. Its IUPAC name is 2-fluoro-1,4-dimethylcyclohexene.
| Compound Name | 2-fluoro-1,4-dimethylcyclohexene |
|---|---|
| PubChem CID | 22942559 |
| Molecular Formula | C8H13F |
| Molecular Weight | 128.19 g/mol |
| Exact Mass | 128.10 |
| IUPAC Name | 2-fluoro-1,4-dimethylcyclohexene |
| SMILES | CC1=C(F)CC(C)CC1 |
| InChI | InChI=1S/C8H13F/c1-6-3-4-7(2)8(9)5-6/h6H,3-5H2,1-2H3 |
| InChIKey | CROKKJCBPVRHHF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.19 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |