C20H24N2O2-2 — CID 22942818
2,4-bis[1-(1-methyl-4-pyridinylidene)ethyl]cyclobutane-1,3-diolate (PubChem CID 22942818) has the molecular formula C20H24N2O2-2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 2,4-bis[1-(1-methyl-4-pyridinylidene)ethyl]cyclobutane-1,3-diolate.
| Compound Name | 2,4-bis[1-(1-methyl-4-pyridinylidene)ethyl]cyclobutane-1,3-diolate |
|---|---|
| PubChem CID | 22942818 |
| Molecular Formula | C20H24N2O2-2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2,4-bis[1-(1-methyl-4-pyridinylidene)ethyl]cyclobutane-1,3-diolate |
| SMILES | CC(=C1C=CN(C)C=C1)C1C([O-])C(C(C)=C2C=CN(C)C=C2)C1[O-] |
| InChI | InChI=1S/C20H24N2O2/c1-13(15-5-9-21(3)10-6-15)17-19(23)18(20(17)24)14(2)16-7-11-22(4)12-8-16/h5-12,17-20H,1-4H3/q-2 |
| InChIKey | OXPVYTFTXUKLEA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |