C21H17N7O3S — CID 22943093
1-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]-3-phenylthiourea (PubChem CID 22943093) has the molecular formula C21H17N7O3S and a molecular weight of 447.48 g/mol. Its IUPAC name is 1-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]-3-phenylthiourea.
| Compound Name | 1-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 22943093 |
| Molecular Formula | C21H17N7O3S |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 1-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]-3-phenylthiourea |
| SMILES | O=C(NNc1ccc(NC(=S)Nc2ccccc2)cc1)n1ncc2c([N+](=O)[O-])cccc21 |
| InChI | InChI=1S/C21H17N7O3S/c29-21(27-18-7-4-8-19(28(30)31)17(18)13-22-27)26-25-16-11-9-15(10-12-16)24-20(32)23-14-5-2-1-3-6-14/h1-13,25H,(H,26,29)(H2,23,24,32) |
| InChIKey | YNONKDMHNHEIHU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|