C9H15N4+ — CID 22944544
1,2-diethyl-6-methyl-7H-pyrazolo[1,5-b][1,2,4]triazol-1-ium (PubChem CID 22944544) has the molecular formula C9H15N4+ and a molecular weight of 179.25 g/mol. Its IUPAC name is 1,2-diethyl-6-methyl-7H-pyrazolo[1,5-b][1,2,4]triazol-1-ium.
| Compound Name | 1,2-diethyl-6-methyl-7H-pyrazolo[1,5-b][1,2,4]triazol-1-ium |
|---|---|
| PubChem CID | 22944544 |
| Molecular Formula | C9H15N4+ |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1,2-diethyl-6-methyl-7H-pyrazolo[1,5-b][1,2,4]triazol-1-ium |
| SMILES | CCc1nn2c([n+]1CC)CC(C)=N2 |
| InChI | InChI=1S/C9H15N4/c1-4-8-11-13-9(12(8)5-2)6-7(3)10-13/h4-6H2,1-3H3/q+1 |
| InChIKey | XWGULCVNNASGLF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|