C7H14N4 — CID 162404014
5-ethyl-4-propyl-1,2,4-triazol-3-amine (PubChem CID 162404014) has the molecular formula C7H14N4 and a molecular weight of 154.22 g/mol. Its IUPAC name is 5-ethyl-4-propyl-1,2,4-triazol-3-amine.
| Compound Name | 5-ethyl-4-propyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 162404014 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 5-ethyl-4-propyl-1,2,4-triazol-3-amine |
| SMILES | CCCn1c(N)nnc1CC |
| InChI | InChI=1S/C7H14N4/c1-3-5-11-6(4-2)9-10-7(11)8/h3-5H2,1-2H3,(H2,8,10) |
| InChIKey | QCCXZOYBJJGPFI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |