C5H11N5 — CID 22946092
(5-methyl-1,3,5-triazinan-2-yl)cyanamide (PubChem CID 22946092) has the molecular formula C5H11N5 and a molecular weight of 141.18 g/mol. Its IUPAC name is (5-methyl-1,3,5-triazinan-2-yl)cyanamide.
| Compound Name | (5-methyl-1,3,5-triazinan-2-yl)cyanamide |
|---|---|
| PubChem CID | 22946092 |
| Molecular Formula | C5H11N5 |
| Molecular Weight | 141.18 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | (5-methyl-1,3,5-triazinan-2-yl)cyanamide |
| SMILES | CN1CNC(NC#N)NC1 |
| InChI | InChI=1S/C5H11N5/c1-10-3-8-5(7-2-6)9-4-10/h5,7-9H,3-4H2,1H3 |
| InChIKey | GELMZMAROYEARQ-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 63.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.18 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|