C17H14ClN3O2 — CID 22946293
1-[3-chloro-4-(1,3-oxazol-5-yl)phenyl]-3-(3-methylphenyl)urea (PubChem CID 22946293) has the molecular formula C17H14ClN3O2 and a molecular weight of 327.77 g/mol. Its IUPAC name is 1-[3-chloro-4-(1,3-oxazol-5-yl)phenyl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[3-chloro-4-(1,3-oxazol-5-yl)phenyl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 22946293 |
| Molecular Formula | C17H14ClN3O2 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 1-[3-chloro-4-(1,3-oxazol-5-yl)phenyl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(-c3cnco3)c(Cl)c2)c1 |
| InChI | InChI=1S/C17H14ClN3O2/c1-11-3-2-4-12(7-11)20-17(22)21-13-5-6-14(15(18)8-13)16-9-19-10-23-16/h2-10H,1H3,(H2,20,21,22) |
| InChIKey | PEPPTNBIRWBVEA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |