C16H12ClN3O2 — CID 2806316
1-(4-chlorophenyl)-3-[4-(1,3-oxazol-5-yl)phenyl]urea (PubChem CID 2806316) has the molecular formula C16H12ClN3O2 and a molecular weight of 313.74 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[4-(1,3-oxazol-5-yl)phenyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[4-(1,3-oxazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 2806316 |
| Molecular Formula | C16H12ClN3O2 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[4-(1,3-oxazol-5-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C16H12ClN3O2/c17-12-3-7-14(8-4-12)20-16(21)19-13-5-1-11(2-6-13)15-9-18-10-22-15/h1-10H,(H2,19,20,21) |
| InChIKey | XEDXLXAFHLMDKR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |