C15H12N2O — CID 5329404
N,5-diphenyl-1,3-oxazol-2-amine (PubChem CID 5329404) has the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. Its IUPAC name is N,5-diphenyl-1,3-oxazol-2-amine.
| Compound Name | N,5-diphenyl-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 5329404 |
| Molecular Formula | C15H12N2O |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | N,5-diphenyl-1,3-oxazol-2-amine |
| SMILES | c1ccc(Nc2ncc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C15H12N2O/c1-3-7-12(8-4-1)14-11-16-15(18-14)17-13-9-5-2-6-10-13/h1-11H,(H,16,17) |
| InChIKey | HFICAVMUTYFODG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |