C16H14N2O2 — CID 5329847
[3-[(5-phenyl-1,3-oxazol-2-yl)amino]phenyl]methanol (PubChem CID 5329847) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is [3-[(5-phenyl-1,3-oxazol-2-yl)amino]phenyl]methanol.
| Compound Name | [3-[(5-phenyl-1,3-oxazol-2-yl)amino]phenyl]methanol |
|---|---|
| PubChem CID | 5329847 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | [3-[(5-phenyl-1,3-oxazol-2-yl)amino]phenyl]methanol |
| SMILES | OCc1cccc(Nc2ncc(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C16H14N2O2/c19-11-12-5-4-8-14(9-12)18-16-17-10-15(20-16)13-6-2-1-3-7-13/h1-10,19H,11H2,(H,17,18) |
| InChIKey | WTSNQZLKTLSHSD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |