C21H16N2O2 — CID 5329851
N-(4-phenoxyphenyl)-5-phenyl-1,3-oxazol-2-amine (PubChem CID 5329851) has the molecular formula C21H16N2O2 and a molecular weight of 328.37 g/mol. Its IUPAC name is N-(4-phenoxyphenyl)-5-phenyl-1,3-oxazol-2-amine.
| Compound Name | N-(4-phenoxyphenyl)-5-phenyl-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 5329851 |
| Molecular Formula | C21H16N2O2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-(4-phenoxyphenyl)-5-phenyl-1,3-oxazol-2-amine |
| SMILES | c1ccc(Oc2ccc(Nc3ncc(-c4ccccc4)o3)cc2)cc1 |
| InChI | InChI=1S/C21H16N2O2/c1-3-7-16(8-4-1)20-15-22-21(25-20)23-17-11-13-19(14-12-17)24-18-9-5-2-6-10-18/h1-15H,(H,22,23) |
| InChIKey | MKASXHWBPFPYNF-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |