C17H16N2O3 — CID 5329853
N-(3,5-dimethoxyphenyl)-5-phenyl-1,3-oxazol-2-amine (PubChem CID 5329853) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-5-phenyl-1,3-oxazol-2-amine.
| Compound Name | N-(3,5-dimethoxyphenyl)-5-phenyl-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 5329853 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-5-phenyl-1,3-oxazol-2-amine |
| SMILES | COc1cc(Nc2ncc(-c3ccccc3)o2)cc(OC)c1 |
| InChI | InChI=1S/C17H16N2O3/c1-20-14-8-13(9-15(10-14)21-2)19-17-18-11-16(22-17)12-6-4-3-5-7-12/h3-11H,1-2H3,(H,18,19) |
| InChIKey | RKNRDRPDYXCRPG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |