C24H27F3N4O — CID 11711943
5-phenyl-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-1,3-oxazol-2-amine (PubChem CID 11711943) has the molecular formula C24H27F3N4O and a molecular weight of 444.50 g/mol. Its IUPAC name is 5-phenyl-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-1,3-oxazol-2-amine.
| Compound Name | 5-phenyl-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 11711943 |
| Molecular Formula | C24H27F3N4O |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 5-phenyl-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-1,3-oxazol-2-amine |
| SMILES | FC(F)(F)c1cccc(N2CCN(CCCCNc3ncc(-c4ccccc4)o3)CC2)c1 |
| InChI | InChI=1S/C24H27F3N4O/c25-24(26,27)20-9-6-10-21(17-20)31-15-13-30(14-16-31)12-5-4-11-28-23-29-18-22(32-23)19-7-2-1-3-8-19/h1-3,6-10,17-18H,4-5,11-16H2,(H,28,29) |
| InChIKey | HXSZWCAHOHIEOA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 44.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|