C10H16O6 — CID 22947141
2-(1,2-dimethoxyethyl)-3,4-dimethoxy-2H-furan-5-one (PubChem CID 22947141) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is 2-(1,2-dimethoxyethyl)-3,4-dimethoxy-2H-furan-5-one.
| Compound Name | 2-(1,2-dimethoxyethyl)-3,4-dimethoxy-2H-furan-5-one |
|---|---|
| PubChem CID | 22947141 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 2-(1,2-dimethoxyethyl)-3,4-dimethoxy-2H-furan-5-one |
| SMILES | COCC(OC)C1OC(=O)C(OC)=C1OC |
| InChI | InChI=1S/C10H16O6/c1-12-5-6(13-2)7-8(14-3)9(15-4)10(11)16-7/h6-7H,5H2,1-4H3 |
| InChIKey | HBATWAXRRCTVJU-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |