About 2-(1,2-dihydroxyethyl)-3-ethoxy-4-hydroxy-2H-furan-5-one
2-(1,2-dihydroxyethyl)-3-ethoxy-4-hydroxy-2H-furan-5-one (PubChem CID 3614716) has the molecular formula C8H12O6
and a molecular weight of 204.18 g/mol. Its IUPAC name is 2-(1,2-dihydroxyethyl)-3-ethoxy-4-hydroxy-2H-furan-5-one.
Molecular Properties
| Compound Name | 2-(1,2-dihydroxyethyl)-3-ethoxy-4-hydroxy-2H-furan-5-one |
| PubChem CID | 3614716 |
| Molecular Formula | C8H12O6 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 2-(1,2-dihydroxyethyl)-3-ethoxy-4-hydroxy-2H-furan-5-one |
| SMILES | CCOC1=C(O)C(=O)OC1C(O)CO |
| InChI | InChI=1S/C8H12O6/c1-2-13-7-5(11)8(12)14-6(7)4(10)3-9/h4,6,9-11H,2-3H2,1H3 |
| InChIKey | ZGSCRDSBTNQPMS-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1,2-dihydroxyethyl)-3-ethoxy-4-hydroxy-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-dihydroxyethyl)-3-ethoxy-4-hydroxy-2H-furan-5-one?
The IUPAC name of 2-(1,2-dihydroxyethyl)-3-ethoxy-4-hydroxy-2H-furan-5-one (CID 3614716) is 2-(1,2-dihydroxyethyl)-3-ethoxy-4-hydroxy-2H-furan-5-one.
What is the SMILES notation for 2-(1,2-dihydroxyethyl)-3-ethoxy-4-hydroxy-2H-furan-5-one?
The canonical SMILES for 2-(1,2-dihydroxyethyl)-3-ethoxy-4-hydroxy-2H-furan-5-one is CCOC1=C(O)C(=O)OC1C(O)CO.
What is the InChIKey of 2-(1,2-dihydroxyethyl)-3-ethoxy-4-hydroxy-2H-furan-5-one?
The InChIKey is ZGSCRDSBTNQPMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O6/c1-2-13-7-5(11)8(12)14-6(7)4(10)3-9/h4,6,9-11H,2-3H2,1H3.
What are the key properties of 2-(1,2-dihydroxyethyl)-3-ethoxy-4-hydroxy-2H-furan-5-one?
2-(1,2-dihydroxyethyl)-3-ethoxy-4-hydroxy-2H-furan-5-one has a molecular weight of 204.18 g/mol, XLogP of -0.93, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dihydroxyethyl)-3-ethoxy-4-hydroxy-2H-furan-5-one is sourced from PubChem (CID 3614716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).