C12H14FeO12 — CID 86763295
bis((2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-olate);iron(2+) (PubChem CID 86763295) has the molecular formula C12H14FeO12 and a molecular weight of 406.08 g/mol. Its IUPAC name is bis((2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-olate);iron(2+).
| Compound Name | bis((2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-olate);iron(2+) |
|---|---|
| PubChem CID | 86763295 |
| Molecular Formula | C12H14FeO12 |
| Molecular Weight | 406.08 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | bis((2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-olate);iron(2+) |
| SMILES | O=C1O[C@H]([C@@H](O)CO)C(O)=C1[O-].O=C1O[C@H]([C@@H](O)CO)C(O)=C1[O-].[Fe+2] |
| InChI | InChI=1S/2C6H8O6.Fe/c2*7-1-2(8)5-3(9)4(10)6(11)12-5;/h2*2,5,7-10H,1H2;/q;;+2/p-2/t2*2-,5+;/m00./s1 |
| InChIKey | RFBYLSCVRUTUSB-ZZMNMWMASA-L |
| XLogP | -5.21 |
| TPSA | 220.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.08 |
| LogP ≤ 5 | -5.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|