About 2-piperidin-1-ylethyl 4-prop-2-enoxybenzoate
2-piperidin-1-ylethyl 4-prop-2-enoxybenzoate (PubChem CID 2294860) has the molecular formula C17H23NO3
and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl 4-prop-2-enoxybenzoate.
Molecular Properties
| Compound Name | 2-piperidin-1-ylethyl 4-prop-2-enoxybenzoate |
| PubChem CID | 2294860 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-piperidin-1-ylethyl 4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(C(=O)OCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C17H23NO3/c1-2-13-20-16-8-6-15(7-9-16)17(19)21-14-12-18-10-4-3-5-11-18/h2,6-9H,1,3-5,10-14H2 |
| InChIKey | OKAYARSPOUDTCC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-1-ylethyl 4-prop-2-enoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylethyl 4-prop-2-enoxybenzoate?
The IUPAC name of 2-piperidin-1-ylethyl 4-prop-2-enoxybenzoate (CID 2294860) is 2-piperidin-1-ylethyl 4-prop-2-enoxybenzoate.
What is the SMILES notation for 2-piperidin-1-ylethyl 4-prop-2-enoxybenzoate?
The canonical SMILES for 2-piperidin-1-ylethyl 4-prop-2-enoxybenzoate is C=CCOc1ccc(C(=O)OCCN2CCCCC2)cc1.
What is the InChIKey of 2-piperidin-1-ylethyl 4-prop-2-enoxybenzoate?
The InChIKey is OKAYARSPOUDTCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO3/c1-2-13-20-16-8-6-15(7-9-16)17(19)21-14-12-18-10-4-3-5-11-18/h2,6-9H,1,3-5,10-14H2.
What are the key properties of 2-piperidin-1-ylethyl 4-prop-2-enoxybenzoate?
2-piperidin-1-ylethyl 4-prop-2-enoxybenzoate has a molecular weight of 289.38 g/mol, XLogP of 2.89, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylethyl 4-prop-2-enoxybenzoate is sourced from PubChem (CID 2294860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).