C14H25NO — CID 22949078
3,4,6,6,7,7,8-heptamethyl-8-azabicyclo[3.2.1]octan-2-one (PubChem CID 22949078) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 3,4,6,6,7,7,8-heptamethyl-8-azabicyclo[3.2.1]octan-2-one.
| Compound Name | 3,4,6,6,7,7,8-heptamethyl-8-azabicyclo[3.2.1]octan-2-one |
|---|---|
| PubChem CID | 22949078 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 3,4,6,6,7,7,8-heptamethyl-8-azabicyclo[3.2.1]octan-2-one |
| SMILES | CC1C(=O)C2N(C)C(C1C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C14H25NO/c1-8-9(2)11-13(3,4)14(5,6)12(10(8)16)15(11)7/h8-9,11-12H,1-7H3 |
| InChIKey | RXHIHPRIVYJLQN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |