C9H13NO — CID 90792635
1-azatricyclo[4.4.0.02,8]decan-3-one (PubChem CID 90792635) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-azatricyclo[4.4.0.02,8]decan-3-one.
| Compound Name | 1-azatricyclo[4.4.0.02,8]decan-3-one |
|---|---|
| PubChem CID | 90792635 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 1-azatricyclo[4.4.0.02,8]decan-3-one |
| SMILES | O=C1CCC2CC3CCN2C13 |
| InChI | InChI=1S/C9H13NO/c11-8-2-1-7-5-6-3-4-10(7)9(6)8/h6-7,9H,1-5H2 |
| InChIKey | DJJVHADHZYSHKU-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |