C7H10FNS — CID 22949810
2-(fluoromethyl)-4-propan-2-yl-1,3-thiazole (PubChem CID 22949810) has the molecular formula C7H10FNS and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-(fluoromethyl)-4-propan-2-yl-1,3-thiazole.
| Compound Name | 2-(fluoromethyl)-4-propan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 22949810 |
| Molecular Formula | C7H10FNS |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 2-(fluoromethyl)-4-propan-2-yl-1,3-thiazole |
| SMILES | CC(C)c1csc(CF)n1 |
| InChI | InChI=1S/C7H10FNS/c1-5(2)6-4-10-7(3-8)9-6/h4-5H,3H2,1-2H3 |
| InChIKey | BLISNNJPFSHIAB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |