C10H22O2 — CID 22950272
3,4-dimethoxy-2,5-dimethylhexane (PubChem CID 22950272) has the molecular formula C10H22O2 and a molecular weight of 174.28 g/mol. Its IUPAC name is 3,4-dimethoxy-2,5-dimethylhexane.
| Compound Name | 3,4-dimethoxy-2,5-dimethylhexane |
|---|---|
| PubChem CID | 22950272 |
| Molecular Formula | C10H22O2 |
| Molecular Weight | 174.28 g/mol |
| Exact Mass | 174.16 |
| IUPAC Name | 3,4-dimethoxy-2,5-dimethylhexane |
| SMILES | COC(C(C)C)C(OC)C(C)C |
| InChI | InChI=1S/C10H22O2/c1-7(2)9(11-5)10(12-6)8(3)4/h7-10H,1-6H3 |
| InChIKey | UFMPQHWYHQFOPZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |