About 3,4-dimethoxy-2,5-dimethylhexane
3,4-dimethoxy-2,5-dimethylhexane (PubChem CID 22950272) has the molecular formula C10H22O2
and a molecular weight of 174.28 g/mol. Its IUPAC name is 3,4-dimethoxy-2,5-dimethylhexane.
Molecular Properties
| Compound Name | 3,4-dimethoxy-2,5-dimethylhexane |
| PubChem CID | 22950272 |
| Molecular Formula | C10H22O2 |
| Molecular Weight | 174.28 g/mol |
| Exact Mass | 174.16 |
| IUPAC Name | 3,4-dimethoxy-2,5-dimethylhexane |
| SMILES | COC(C(C)C)C(OC)C(C)C |
| InChI | InChI=1S/C10H22O2/c1-7(2)9(11-5)10(12-6)8(3)4/h7-10H,1-6H3 |
| InChIKey | UFMPQHWYHQFOPZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dimethoxy-2,5-dimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethoxy-2,5-dimethylhexane?
The IUPAC name of 3,4-dimethoxy-2,5-dimethylhexane (CID 22950272) is 3,4-dimethoxy-2,5-dimethylhexane.
What is the SMILES notation for 3,4-dimethoxy-2,5-dimethylhexane?
The canonical SMILES for 3,4-dimethoxy-2,5-dimethylhexane is COC(C(C)C)C(OC)C(C)C.
What is the InChIKey of 3,4-dimethoxy-2,5-dimethylhexane?
The InChIKey is UFMPQHWYHQFOPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O2/c1-7(2)9(11-5)10(12-6)8(3)4/h7-10H,1-6H3.
What are the key properties of 3,4-dimethoxy-2,5-dimethylhexane?
3,4-dimethoxy-2,5-dimethylhexane has a molecular weight of 174.28 g/mol, XLogP of 2.33, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethoxy-2,5-dimethylhexane is sourced from PubChem (CID 22950272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).