C8H15N3 — CID 22950941
3-butyl-4,5-dimethyl-1,2,4-triazole (PubChem CID 22950941) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 3-butyl-4,5-dimethyl-1,2,4-triazole.
| Compound Name | 3-butyl-4,5-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 22950941 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 3-butyl-4,5-dimethyl-1,2,4-triazole |
| SMILES | CCCCc1nnc(C)n1C |
| InChI | InChI=1S/C8H15N3/c1-4-5-6-8-10-9-7(2)11(8)3/h4-6H2,1-3H3 |
| InChIKey | VPAFYEIWURUKRJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |