C20H25N3S — CID 22951324
4-[(3-cyclopentyl-1-thia-3-azaspiro[4.4]nonan-2-ylidene)amino]-3-methylbenzonitrile (PubChem CID 22951324) has the molecular formula C20H25N3S and a molecular weight of 339.51 g/mol. Its IUPAC name is 4-[(3-cyclopentyl-1-thia-3-azaspiro[4.4]nonan-2-ylidene)amino]-3-methylbenzonitrile.
| Compound Name | 4-[(3-cyclopentyl-1-thia-3-azaspiro[4.4]nonan-2-ylidene)amino]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 22951324 |
| Molecular Formula | C20H25N3S |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 4-[(3-cyclopentyl-1-thia-3-azaspiro[4.4]nonan-2-ylidene)amino]-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1/N=C1\SC2(CCCC2)CN1C1CCCC1 |
| InChI | InChI=1S/C20H25N3S/c1-15-12-16(13-21)8-9-18(15)22-19-23(17-6-2-3-7-17)14-20(24-19)10-4-5-11-20/h8-9,12,17H,2-7,10-11,14H2,1H3/b22-19- |
| InChIKey | IMZXGDYRKFZYHZ-QOCHGBHMSA-N |
| XLogP | 5.16 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|