C22H29N3S — CID 18316207
4-[(3-cyclopentyl-1-thia-3-azaspiro[4.4]nonan-2-ylidene)amino]-3-propylbenzonitrile (PubChem CID 18316207) has the molecular formula C22H29N3S and a molecular weight of 367.56 g/mol. Its IUPAC name is 4-[(3-cyclopentyl-1-thia-3-azaspiro[4.4]nonan-2-ylidene)amino]-3-propylbenzonitrile.
| Compound Name | 4-[(3-cyclopentyl-1-thia-3-azaspiro[4.4]nonan-2-ylidene)amino]-3-propylbenzonitrile |
|---|---|
| PubChem CID | 18316207 |
| Molecular Formula | C22H29N3S |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 4-[(3-cyclopentyl-1-thia-3-azaspiro[4.4]nonan-2-ylidene)amino]-3-propylbenzonitrile |
| SMILES | CCCc1cc(C#N)ccc1/N=C1\SC2(CCCC2)CN1C1CCCC1 |
| InChI | InChI=1S/C22H29N3S/c1-2-7-18-14-17(15-23)10-11-20(18)24-21-25(19-8-3-4-9-19)16-22(26-21)12-5-6-13-22/h10-11,14,19H,2-9,12-13,16H2,1H3/b24-21- |
| InChIKey | LSVUMRBTWJPNNJ-FLFQWRMESA-N |
| XLogP | 5.80 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|