C20H29N3S — CID 57072426
4-[[(4S)-4-butyl-3-(2-methylpropyl)-1,3-thiazolidin-2-ylidene]amino]-3-ethylbenzonitrile (PubChem CID 57072426) has the molecular formula C20H29N3S and a molecular weight of 343.54 g/mol. Its IUPAC name is 4-[[(4S)-4-butyl-3-(2-methylpropyl)-1,3-thiazolidin-2-ylidene]amino]-3-ethylbenzonitrile.
| Compound Name | 4-[[(4S)-4-butyl-3-(2-methylpropyl)-1,3-thiazolidin-2-ylidene]amino]-3-ethylbenzonitrile |
|---|---|
| PubChem CID | 57072426 |
| Molecular Formula | C20H29N3S |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 4-[[(4S)-4-butyl-3-(2-methylpropyl)-1,3-thiazolidin-2-ylidene]amino]-3-ethylbenzonitrile |
| SMILES | CCCC[C@H]1CS/C(=N\c2ccc(C#N)cc2CC)N1CC(C)C |
| InChI | InChI=1S/C20H29N3S/c1-5-7-8-18-14-24-20(23(18)13-15(3)4)22-19-10-9-16(12-21)11-17(19)6-2/h9-11,15,18H,5-8,13-14H2,1-4H3/b22-20-/t18-/m0/s1 |
| InChIKey | RMJMFWBTHPKAQJ-BKBKCADHSA-N |
| XLogP | 5.37 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|