C22H18ClN5 — CID 22953876
4-[[3-(4-chlorophenyl)-4-pyridin-4-yl-1H-pyrazol-5-yl]methyl]benzenecarboximidamide (PubChem CID 22953876) has the molecular formula C22H18ClN5 and a molecular weight of 387.87 g/mol. Its IUPAC name is 4-[[3-(4-chlorophenyl)-4-pyridin-4-yl-1H-pyrazol-5-yl]methyl]benzenecarboximidamide.
| Compound Name | 4-[[3-(4-chlorophenyl)-4-pyridin-4-yl-1H-pyrazol-5-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 22953876 |
| Molecular Formula | C22H18ClN5 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 4-[[3-(4-chlorophenyl)-4-pyridin-4-yl-1H-pyrazol-5-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Cc2[nH]nc(-c3ccc(Cl)cc3)c2-c2ccncc2)cc1 |
| InChI | InChI=1S/C22H18ClN5/c23-18-7-5-16(6-8-18)21-20(15-9-11-26-12-10-15)19(27-28-21)13-14-1-3-17(4-2-14)22(24)25/h1-12H,13H2,(H3,24,25)(H,27,28) |
| InChIKey | MEEWOYJRTQGSBB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|