C24H27ClN4O2 — CID 22954116
N-[4-[3-(4-chlorophenyl)-4-pyridin-4-yl-1H-pyrazol-5-yl]cycloheptyl]-2-methoxyacetamide (PubChem CID 22954116) has the molecular formula C24H27ClN4O2 and a molecular weight of 438.96 g/mol. Its IUPAC name is N-[4-[3-(4-chlorophenyl)-4-pyridin-4-yl-1H-pyrazol-5-yl]cycloheptyl]-2-methoxyacetamide.
| Compound Name | N-[4-[3-(4-chlorophenyl)-4-pyridin-4-yl-1H-pyrazol-5-yl]cycloheptyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 22954116 |
| Molecular Formula | C24H27ClN4O2 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-[4-[3-(4-chlorophenyl)-4-pyridin-4-yl-1H-pyrazol-5-yl]cycloheptyl]-2-methoxyacetamide |
| SMILES | COCC(=O)NC1CCCC(c2[nH]nc(-c3ccc(Cl)cc3)c2-c2ccncc2)CC1 |
| InChI | InChI=1S/C24H27ClN4O2/c1-31-15-21(30)27-20-4-2-3-17(7-10-20)23-22(16-11-13-26-14-12-16)24(29-28-23)18-5-8-19(25)9-6-18/h5-6,8-9,11-14,17,20H,2-4,7,10,15H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | PXZMYARWTTZJGF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |