C21H27N5O7 — CID 22954994
3-[[7-(methylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-4-oxo-5-pyridin-3-yloxypentanoic acid (PubChem CID 22954994) has the molecular formula C21H27N5O7 and a molecular weight of 461.48 g/mol. Its IUPAC name is 3-[[7-(methylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-4-oxo-5-pyridin-3-yloxypentanoic acid.
| Compound Name | 3-[[7-(methylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-4-oxo-5-pyridin-3-yloxypentanoic acid |
|---|---|
| PubChem CID | 22954994 |
| Molecular Formula | C21H27N5O7 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 3-[[7-(methylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-4-oxo-5-pyridin-3-yloxypentanoic acid |
| SMILES | CNC1CCC(=O)N2CCCC(C(=O)NC(CC(=O)O)C(=O)COc3cccnc3)N2C1=O |
| InChI | InChI=1S/C21H27N5O7/c1-22-14-6-7-18(28)25-9-3-5-16(26(25)21(14)32)20(31)24-15(10-19(29)30)17(27)12-33-13-4-2-8-23-11-13/h2,4,8,11,14-16,22H,3,5-7,9-10,12H2,1H3,(H,24,31)(H,29,30) |
| InChIKey | DTIQMDNVPTXPJZ-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 158.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |