C24H30Cl2N4O6 — CID 59960832
[(3S)-3-[[(4S,7S)-7-(methylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-2-oxohexyl] 2,6-dichlorobenzoate (PubChem CID 59960832) has the molecular formula C24H30Cl2N4O6 and a molecular weight of 541.43 g/mol. Its IUPAC name is [(3S)-3-[[(4S,7S)-7-(methylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-2-oxohexyl] 2,6-dichlorobenzoate.
| Compound Name | [(3S)-3-[[(4S,7S)-7-(methylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-2-oxohexyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 59960832 |
| Molecular Formula | C24H30Cl2N4O6 |
| Molecular Weight | 541.43 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | [(3S)-3-[[(4S,7S)-7-(methylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-2-oxohexyl] 2,6-dichlorobenzoate |
| SMILES | CCC[C@H](NC(=O)[C@@H]1CCCN2C(=O)CC[C@H](NC)C(=O)N12)C(=O)COC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H30Cl2N4O6/c1-3-6-16(19(31)13-36-24(35)21-14(25)7-4-8-15(21)26)28-22(33)18-9-5-12-29-20(32)11-10-17(27-2)23(34)30(18)29/h4,7-8,16-18,27H,3,5-6,9-13H2,1-2H3,(H,28,33)/t16-,17-,18-/m0/s1 |
| InChIKey | DSNJLIYEITVOFF-BZSNNMDCSA-N |
| XLogP | 2.12 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |