C26H26Cl2N4O8 — CID 10188744
[(3S)-3-[[(4S,7S)-7-(furan-2-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-2-oxobutyl] 2,6-dichlorobenzoate (PubChem CID 10188744) has the molecular formula C26H26Cl2N4O8 and a molecular weight of 593.42 g/mol. Its IUPAC name is [(3S)-3-[[(4S,7S)-7-(furan-2-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-2-oxobutyl] 2,6-dichlorobenzoate.
| Compound Name | [(3S)-3-[[(4S,7S)-7-(furan-2-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-2-oxobutyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 10188744 |
| Molecular Formula | C26H26Cl2N4O8 |
| Molecular Weight | 593.42 g/mol |
| Exact Mass | 592.11 |
| IUPAC Name | [(3S)-3-[[(4S,7S)-7-(furan-2-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-2-oxobutyl] 2,6-dichlorobenzoate |
| SMILES | C[C@H](NC(=O)[C@@H]1CCCN2C(=O)CC[C@H](NC(=O)c3ccco3)C(=O)N12)C(=O)COC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C26H26Cl2N4O8/c1-14(19(33)13-40-26(38)22-15(27)5-2-6-16(22)28)29-23(35)18-7-3-11-31-21(34)10-9-17(25(37)32(18)31)30-24(36)20-8-4-12-39-20/h2,4-6,8,12,14,17-18H,3,7,9-11,13H2,1H3,(H,29,35)(H,30,36)/t14-,17-,18-/m0/s1 |
| InChIKey | YHSUZQOCYSEHDP-WBAXXEDZSA-N |
| XLogP | 2.14 |
| TPSA | 155.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |