C22H28N6O6 — CID 90755142
(4S,7S)-N-[(3S)-1-diazo-5-methyl-2-oxohexan-3-yl]-7-(furan-2-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide (PubChem CID 90755142) has the molecular formula C22H28N6O6 and a molecular weight of 472.50 g/mol. Its IUPAC name is (4S,7S)-N-[(3S)-1-diazo-5-methyl-2-oxohexan-3-yl]-7-(furan-2-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide.
| Compound Name | (4S,7S)-N-[(3S)-1-diazo-5-methyl-2-oxohexan-3-yl]-7-(furan-2-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide |
|---|---|
| PubChem CID | 90755142 |
| Molecular Formula | C22H28N6O6 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | (4S,7S)-N-[(3S)-1-diazo-5-methyl-2-oxohexan-3-yl]-7-(furan-2-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H]1CCCN2C(=O)CC[C@H](NC(=O)c3ccco3)C(=O)N12)C(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C22H28N6O6/c1-13(2)11-15(17(29)12-24-23)26-20(31)16-5-3-9-27-19(30)8-7-14(22(33)28(16)27)25-21(32)18-6-4-10-34-18/h4,6,10,12-16H,3,5,7-9,11H2,1-2H3,(H,25,32)(H,26,31)/t14-,15-,16-/m0/s1 |
| InChIKey | GGOOWLHAJYJISI-JYJNAYRXSA-N |
| XLogP | 0.31 |
| TPSA | 165.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|