C27H29N7O6 — CID 90718730
(4S,7S)-N-[(2S)-4-diazo-3-oxobutan-2-yl]-6,10-dioxo-7-[(4-phenoxyphenyl)carbamoylamino]-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide (PubChem CID 90718730) has the molecular formula C27H29N7O6 and a molecular weight of 547.57 g/mol. Its IUPAC name is (4S,7S)-N-[(2S)-4-diazo-3-oxobutan-2-yl]-6,10-dioxo-7-[(4-phenoxyphenyl)carbamoylamino]-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide.
| Compound Name | (4S,7S)-N-[(2S)-4-diazo-3-oxobutan-2-yl]-6,10-dioxo-7-[(4-phenoxyphenyl)carbamoylamino]-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide |
|---|---|
| PubChem CID | 90718730 |
| Molecular Formula | C27H29N7O6 |
| Molecular Weight | 547.57 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | (4S,7S)-N-[(2S)-4-diazo-3-oxobutan-2-yl]-6,10-dioxo-7-[(4-phenoxyphenyl)carbamoylamino]-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide |
| SMILES | C[C@H](NC(=O)[C@@H]1CCCN2C(=O)CC[C@H](NC(=O)Nc3ccc(Oc4ccccc4)cc3)C(=O)N12)C(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C27H29N7O6/c1-17(23(35)16-29-28)30-25(37)22-8-5-15-33-24(36)14-13-21(26(38)34(22)33)32-27(39)31-18-9-11-20(12-10-18)40-19-6-3-2-4-7-19/h2-4,6-7,9-12,16-17,21-22H,5,8,13-15H2,1H3,(H,30,37)(H2,31,32,39)/t17-,21-,22-/m0/s1 |
| InChIKey | RJNOAGIAOAYSIZ-HSQYWUDLSA-N |
| XLogP | 1.87 |
| TPSA | 173.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.57 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|