C9H13NO4 — CID 22956495
prop-2-enyl N-(2-methyl-5-oxooxolan-3-yl)carbamate (PubChem CID 22956495) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is prop-2-enyl N-(2-methyl-5-oxooxolan-3-yl)carbamate.
| Compound Name | prop-2-enyl N-(2-methyl-5-oxooxolan-3-yl)carbamate |
|---|---|
| PubChem CID | 22956495 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | prop-2-enyl N-(2-methyl-5-oxooxolan-3-yl)carbamate |
| SMILES | C=CCOC(=O)NC1CC(=O)OC1C |
| InChI | InChI=1S/C9H13NO4/c1-3-4-13-9(12)10-7-5-8(11)14-6(7)2/h3,6-7H,1,4-5H2,2H3,(H,10,12) |
| InChIKey | IDYOQLZNBGAZDM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|